CymitQuimica logo

CAS 113641-45-5

:

6-Fluoro-2,5-dimethylquinoline

Description:
6-Fluoro-2,5-dimethylquinoline is a heterocyclic organic compound characterized by its quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of a fluorine atom at the 6-position and two methyl groups at the 2 and 5 positions contributes to its unique chemical properties. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. Its molecular structure allows for potential applications in pharmaceuticals, particularly in the development of antimicrobial and anticancer agents, due to the biological activity often associated with quinoline derivatives. The fluorine substituent can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, 6-Fluoro-2,5-dimethylquinoline may undergo various chemical reactions, including electrophilic substitutions and nucleophilic attacks, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H10FN
InChI:InChI=1S/C11H10FN/c1-7-3-4-9-8(2)10(12)5-6-11(9)13-7/h3-6H,1-2H3
InChI key:InChIKey=ATWVWVWZFFCWOV-UHFFFAOYSA-N
SMILES:CC=1C2=C(N=C(C)C=C2)C=CC1F
Synonyms:
  • Quinoline, 6-fluoro-2,5-dimethyl-
  • 6-Fluoro-2,5-dimethylquinoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.