CymitQuimica logo

CAS 113641-49-9

:

1,1′-(1-Methylethylidene)bis[4-methoxy-3-(2-propen-1-yl)benzene]

Description:
1,1′-(1-Methylethylidene)bis[4-methoxy-3-(2-propen-1-yl)benzene], identified by its CAS number 113641-49-9, is an organic compound characterized by its complex structure featuring two aromatic rings connected by a methylethylidene bridge. This compound contains methoxy groups and propenyl substituents, which contribute to its reactivity and potential applications in organic synthesis and materials science. The presence of multiple functional groups suggests that it may exhibit interesting chemical properties, such as the ability to undergo various reactions like polymerization or electrophilic substitution. Additionally, the compound's structure indicates potential uses in the development of specialty chemicals, fragrances, or as intermediates in the synthesis of more complex molecules. Its physical properties, such as solubility, melting point, and boiling point, would depend on the specific interactions of its functional groups and the overall molecular structure. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C23H28O2
InChI:InChI=1S/C23H28O2/c1-7-9-17-15-19(11-13-21(17)24-5)23(3,4)20-12-14-22(25-6)18(16-20)10-8-2/h7-8,11-16H,1-2,9-10H2,3-6H3
InChI key:InChIKey=YJBOZIJFBVOJFA-UHFFFAOYSA-N
SMILES:C(C)(C)(C1=CC(CC=C)=C(OC)C=C1)C2=CC(CC=C)=C(OC)C=C2
Synonyms:
  • 1,1′-(1-Methylethylidene)bis[4-methoxy-3-(2-propen-1-yl)benzene]
  • Benzene, 1,1′-(1-methylethylidene)bis[4-methoxy-3-(2-propen-1-yl)-
  • Benzene, 1,1′-(1-methylethylidene)bis[4-methoxy-3-(2-propenyl)-
  • 2,2-Bis(3-allyl-4-methoxyphenyl)propane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.