CymitQuimica logo

CAS 113662-55-8

:

2-(Chloromethyl)cyclohexanol

Description:
2-(Chloromethyl)cyclohexanol is an organic compound characterized by a cyclohexane ring with a hydroxyl group (-OH) and a chloromethyl group (-CH2Cl) attached to it. This compound is classified as a secondary alcohol due to the presence of the hydroxyl group on a carbon that is bonded to two other carbon atoms. The chloromethyl group introduces a halogen, which can enhance the reactivity of the molecule, making it useful in various chemical reactions, such as nucleophilic substitutions. The presence of both functional groups contributes to its potential applications in organic synthesis, particularly in the production of more complex molecules. Additionally, the compound's structure suggests it may exhibit moderate polarity, influencing its solubility in different solvents. Safety considerations are important when handling this compound, as it may pose health risks due to the presence of chlorine and the potential for reactivity. Overall, 2-(Chloromethyl)cyclohexanol serves as a valuable intermediate in chemical synthesis and research.
Formula:C7H13ClO
InChI:InChI=1S/C7H13ClO/c8-5-6-3-1-2-4-7(6)9/h6-7,9H,1-5H2
InChI key:InChIKey=UTAROSANKCOAPY-UHFFFAOYSA-N
SMILES:C(Cl)C1C(O)CCCC1
Synonyms:
  • Cyclohexanol, 2-(chloromethyl)-
  • 2-(Chloromethyl)cyclohexanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.