CAS 113668-38-5

Glycine, N-[S-(chloroacetyl)-N-L-γ-glutamyl-L-cysteinyl]-

Description:

Glycine, N-[S-(chloroacetyl)-N-L-γ-glutamyl-L-cysteinyl]- is a synthetic peptide derivative characterized by its unique structure, which includes a glycine backbone and modifications that incorporate a chloroacetyl group and a γ-glutamyl-L-cysteinyl moiety. This compound is notable for its potential biological activity, particularly in the context of peptide synthesis and medicinal chemistry. The presence of the chloroacetyl group suggests reactivity that could facilitate further chemical modifications or interactions with biological targets. Additionally, the incorporation of amino acids such as γ-glutamate and cysteine may impart specific properties related to protein interactions, stability, and solubility. This compound may be of interest in research areas such as drug development, where peptide-based therapeutics are explored for their efficacy and specificity. As with many synthetic peptides, its stability, solubility, and biological activity would depend on the conditions of use and the presence of other interacting molecules.

Formula: C₁₂H₁₈ClN₃O₇S

InChI: InChI=1S/C12H18ClN3O7S/c13-3-10(20)24-5-7(11(21)15-4-9(18)19)16-8(17)2-1-6(14)12(22)23/h6-7H,1-5,14H2,(H,15,21)(H,16,17)(H,18,19)(H,22,23)/t6-,7-/m0/s1

InChI key: InChIKey=QJDRMMRBPVHMAD-BQBZGAKWSA-N

SMILES: [C@H](C(NCC(O)=O)=O)(NC(CC[C@@H](C(O)=O)N)=O)CSC(CCl)=O

Synonyms:

• Glycine, N-[S-(chloroacetyl)-N-L-γ-glutamyl-L-cysteinyl]-

Glycine, N-[S-(chloroacetyl)-N-L-γ-glutamyl-L-cysteinyl]- (9CI)

CAS: 113668-38-5

Formula: C₁₂H₁₈ClN₃O₇S

Molecular weight: 383.8052

Ref: IN-DA00099O