CAS 113674-96-7

Hydrazinecarboxaldehyde, [1-(4-methoxyphenyl)ethylidene]-

Description:

Hydrazinecarboxaldehyde, [1-(4-methoxyphenyl)ethylidene]-, with the CAS number 113674-96-7, is an organic compound characterized by the presence of both hydrazine and aldehyde functional groups. This compound typically exhibits a yellow to brownish color and is soluble in polar organic solvents. Its structure features a hydrazine moiety linked to an ethylidene group that is further substituted with a para-methoxyphenyl group, contributing to its unique chemical properties. The presence of the methoxy group enhances its electron-donating ability, which can influence its reactivity and interactions with other chemical species. Hydrazine derivatives are known for their applications in various fields, including pharmaceuticals, agriculture, and as intermediates in organic synthesis. However, due to the potential toxicity and reactivity of hydrazine compounds, appropriate safety measures should be taken when handling this substance. Overall, the compound's characteristics make it a subject of interest in both research and industrial applications.

Formula: C₁₀H₁₂N₂O₂

InChI: InChI=1S/C10H12N2O2/c1-8(12-11-7-13)9-3-5-10(14-2)6-4-9/h3-7H,1-2H3,(H,11,13)

InChI key: InChIKey=NBCVQZNXWVDBEA-UHFFFAOYSA-N

SMILES: C(=NNC=O)(C)C1=CC=C(OC)C=C1

Synonyms:

• Hydrazinecarboxaldehyde, [1-(4-methoxyphenyl)ethylidene]-

Hydrazinecarboxaldehyde, [1-(4-methoxyphenyl)ethylidene]- (9CI)

CAS: 113674-96-7

Formula: C₁₀H₁₂N₂O₂

Molecular weight: 192.2145

Ref: IN-DA00099E