CymitQuimica logo

CAS 113680-55-0

:

3,17?-O-BIS(METHOXYMETHYL)ESTRADIOL

Description:
3,17?-O-Bis(methoxymethyl)estradiol is a synthetic derivative of estradiol, a naturally occurring estrogen hormone. This compound is characterized by the presence of two methoxymethyl groups at the 3 and 17 positions of the estradiol structure, which enhances its lipophilicity and alters its biological activity. It is typically used in research settings to study estrogenic effects and mechanisms of action. The modification of the estradiol backbone can influence its receptor binding affinity, metabolic stability, and overall pharmacological profile. As a chemical entity, it may exhibit properties such as solubility in organic solvents and potential reactivity due to the presence of methoxy groups. Its application in medicinal chemistry often revolves around the development of hormone replacement therapies or contraceptives. However, specific safety and handling guidelines should be followed, as with any chemical substance, due to potential biological activity and effects on human health.
Formula:C22H32O4
InChI:InChI=1/C22H32O4/c1-22-11-10-18-17-7-5-16(25-13-23-2)12-15(17)4-6-19(18)20(22)8-9-21(22)26-14-24-3/h5,7,12,18-21H,4,6,8-11,13-14H2,1-3H3/t18-,19-,20+,21+,22+/m1/s1
Synonyms:
  • (17)-3,17-Bis(methoxymethoxy)estra-1,3,5(10)-triene
  • (17Beta)-3,17-Bis(Methoxymethoxy)Estra-1,3,5(10)-Triene
  • 3,17?-O-BIS(METHOXYMETHYL)ESTRADIOL
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.