CymitQuimica logo

CAS 113688-50-9

:

1-Bromo-2-(2-bromo-1,1,2,2-tetrafluoroethyl)cyclohexane

Description:
1-Bromo-2-(2-bromo-1,1,2,2-tetrafluoroethyl)cyclohexane is a halogenated organic compound characterized by the presence of bromine and fluorine substituents on a cyclohexane ring. The compound features a cyclohexane backbone, which contributes to its cyclic structure and influences its physical properties, such as boiling and melting points. The presence of multiple bromine and fluorine atoms introduces significant electronegativity, affecting the compound's reactivity and polarity. This substance is likely to exhibit hydrophobic characteristics due to the fluorinated groups, which can also enhance its thermal and chemical stability. Additionally, the bulky nature of the substituents may lead to steric hindrance, influencing its interactions with other molecules. As a halogenated compound, it may have applications in various fields, including pharmaceuticals and materials science, but its environmental impact and potential toxicity should be considered, particularly due to the presence of bromine and fluorine, which can lead to persistent organic pollutants. Proper handling and disposal measures are essential when working with such substances.
Formula:C8H10Br2F4
InChI:InChI=1S/C8H10Br2F4/c9-6-4-2-1-3-5(6)7(11,12)8(10,13)14/h5-6H,1-4H2
InChI key:InChIKey=OHZOAPHDEMQUJZ-UHFFFAOYSA-N
SMILES:C(C(Br)(F)F)(F)(F)C1C(Br)CCCC1
Synonyms:
  • 1-Bromo-2-(2-bromo-1,1,2,2-tetrafluoroethyl)cyclohexane
  • Cyclohexane, 1-bromo-2-(2-bromo-1,1,2,2-tetrafluoroethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.