CymitQuimica logo

CAS 1136906-30-3

:

8-Amino-1,2,3,4-tetrahydro-2-quinolinecarboxylic acid

Description:
8-Amino-1,2,3,4-tetrahydro-2-quinolinecarboxylic acid is a heterocyclic organic compound characterized by its quinoline structure, which features a fused bicyclic system containing nitrogen. This compound typically exhibits properties associated with amino acids and heterocycles, including the presence of an amino group (-NH2) and a carboxylic acid group (-COOH), which contribute to its potential as a building block in pharmaceuticals and organic synthesis. The tetrahydro configuration indicates that the compound is saturated, which can influence its reactivity and solubility. It may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of drugs targeting various diseases. The presence of the quinoline moiety often correlates with diverse pharmacological properties, including antimicrobial and anti-inflammatory effects. Additionally, the compound's solubility and stability can vary depending on pH and solvent conditions, which are important factors to consider in its application and formulation. Overall, 8-Amino-1,2,3,4-tetrahydro-2-quinolinecarboxylic acid represents a versatile compound with potential utility in various chemical and biological contexts.
Formula:C10H12N2O2
InChI:InChI=1S/C10H12N2O2/c11-7-3-1-2-6-4-5-8(10(13)14)12-9(6)7/h1-3,8,12H,4-5,11H2,(H,13,14)
InChI key:InChIKey=WOAXPFZIKBDPKV-UHFFFAOYSA-N
SMILES:NC1=C2C(CCC(C(O)=O)N2)=CC=C1
Synonyms:
  • 8-Amino-1,2,3,4-tetrahydro-2-quinolinecarboxylic acid
  • 2-Quinolinecarboxylic acid, 8-amino-1,2,3,4-tetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.