CAS 113697-05-5

1,4-Dihydro-7-methoxy-6-(phenylmethoxy)-3H-2-benzopyran-3-one

Description:

1,4-Dihydro-7-methoxy-6-(phenylmethoxy)-3H-2-benzopyran-3-one, with CAS number 113697-05-5, is a synthetic organic compound belonging to the class of benzopyran derivatives. This compound features a benzopyran core, which is characterized by a fused benzene and pyran ring structure, contributing to its potential biological activity. The presence of methoxy groups enhances its solubility and may influence its reactivity and interaction with biological targets. The phenylmethoxy substituent adds to its structural complexity and may play a role in modulating its pharmacological properties. Generally, compounds of this type are studied for their potential applications in medicinal chemistry, particularly for their antioxidant, anti-inflammatory, or anticancer activities. The specific characteristics, such as melting point, solubility, and spectral data, would typically be determined through experimental methods and are essential for understanding its behavior in various chemical environments. Overall, this compound represents a class of molecules with significant interest in drug development and therapeutic applications.

Formula: C₁₇H₁₆O₄

InChI: InChI=1S/C17H16O4/c1-19-15-8-14-11-21-17(18)9-13(14)7-16(15)20-10-12-5-3-2-4-6-12/h2-8H,9-11H2,1H3

InChI key: InChIKey=AGNJMUJGYBJQHL-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C=2C=C3C(=CC2OC)COC(=O)C3

Synonyms:

• 1,4-Dihydro-7-methoxy-6-(phenylmethoxy)-3H-2-benzopyran-3-one
• 3H-2-Benzopyran-3-one, 1,4-dihydro-7-methoxy-6-(phenylmethoxy)-