CAS 113697-06-6

1H-Pyrrole, 2,2′-dithiobis[1-[(4-methylphenyl)sulfonyl]-

Description:

1H-Pyrrole, 2,2′-dithiobis[1-[(4-methylphenyl)sulfonyl]-] is a chemical compound characterized by its unique structure, which includes a pyrrole ring and dithiobis functionality. This compound features two sulfonyl groups attached to a pyrrole moiety, contributing to its potential reactivity and applications in various chemical processes. The presence of the 4-methylphenyl group enhances its lipophilicity, which may influence its solubility and interaction with biological systems. Typically, compounds of this nature are studied for their roles in organic synthesis, materials science, and potentially in medicinal chemistry due to their ability to participate in various chemical reactions, such as nucleophilic substitutions or polymerization. The compound's CAS number, 113697-06-6, allows for easy identification and retrieval of data related to its properties, safety, and handling guidelines. As with many chemical substances, proper safety measures should be observed when handling this compound, including the use of personal protective equipment and adherence to relevant safety protocols.

Formula: C₂₂H₂₀N₂O₄S₄

InChI: InChI=1S/C22H20N2O4S4/c1-17-7-11-19(12-8-17)31(25,26)23-15-3-5-21(23)29-30-22-6-4-16-24(22)32(27,28)20-13-9-18(2)10-14-20/h3-16H,1-2H3

InChI key: InChIKey=AJQNOJFDGMCBTI-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1C(SSC=2N(S(=O)(=O)C3=CC=C(C)C=C3)C=CC2)=CC=C1)C4=CC=C(C)C=C4

Synonyms:

• 1H-Pyrrole, 2,2′-dithiobis[1-[(4-methylphenyl)sulfonyl]-

1H-Pyrrole, 2,2'-dithiobis[1-[(4-methylphenyl)sulfonyl]- (9CI)

CAS: 113697-06-6

Formula: C₂₂H₂₀N₂O₄S₄

Molecular weight: 504.6652

Ref: IN-DA0009C3