
CAS 113698-11-6
:4-Hydrazinyl-7-methoxy-2-methyl-8-quinolinamine
Description:
4-Hydrazinyl-7-methoxy-2-methyl-8-quinolinamine, identified by its CAS number 113698-11-6, is a chemical compound that belongs to the class of quinoline derivatives. This substance features a hydrazine functional group, which is known for its reactivity and potential applications in various chemical reactions, including as a reducing agent. The presence of a methoxy group and a methyl group on the quinoline ring contributes to its unique chemical properties, influencing its solubility and reactivity. Quinoline derivatives are often studied for their biological activities, including potential antimicrobial and anticancer properties. The specific arrangement of substituents in this compound may also affect its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature, which are important considerations in both laboratory and industrial applications. Overall, 4-Hydrazinyl-7-methoxy-2-methyl-8-quinolinamine represents a significant structure for further research in chemical and pharmaceutical fields.
Formula:C11H14N4O
InChI:InChI=1S/C11H14N4O/c1-6-5-8(15-13)7-3-4-9(16-2)10(12)11(7)14-6/h3-5H,12-13H2,1-2H3,(H,14,15)
InChI key:InChIKey=XXTFTSDDIJTTKU-UHFFFAOYSA-N
SMILES:N(N)C=1C2=C(C(N)=C(OC)C=C2)N=C(C)C1
Synonyms:- 8-Quinolinamine, 4-hydrazinyl-7-methoxy-2-methyl-
- 4-Hydrazinyl-7-methoxy-2-methyl-8-quinolinamine
- 8-Quinolinamine, 4-hydrazino-7-methoxy-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.