CymitQuimica logo

CAS 113699-75-5

:

Piperazine, 1-(phenyl-2-pyridinylmethyl)-

Description:
Piperazine, 1-(phenyl-2-pyridinylmethyl)-, with the CAS number 113699-75-5, is a chemical compound that belongs to the class of piperazines, which are cyclic organic compounds containing a piperazine ring. This particular compound features a phenyl group and a pyridinylmethyl substituent, contributing to its unique chemical properties. It is typically characterized by its moderate polarity, which influences its solubility in various solvents, and it may exhibit biological activity, making it of interest in medicinal chemistry. The presence of both the phenyl and pyridine moieties can enhance its interaction with biological targets, potentially leading to pharmacological effects. Additionally, piperazine derivatives are known for their applications in pharmaceuticals, particularly as anxiolytics, antidepressants, and antipsychotics. The compound's structure suggests potential for further derivatization, which could lead to the development of new therapeutic agents. As with many piperazine derivatives, safety and toxicity profiles would need to be evaluated in the context of its intended use.
Formula:C16H19N3
InChI:InChI=1S/C16H19N3/c1-2-6-14(7-3-1)16(15-8-4-5-9-18-15)19-12-10-17-11-13-19/h1-9,16-17H,10-13H2
InChI key:DFOZOWZBUMYFDD-UHFFFAOYSA-N
SMILES:C1CN(CCN1)C(C2=CC=CC=C2)C3=CC=CC=N3
Found 2 products.