
CAS 1137-12-8
:Longicyclene
Description:
Longicyclene, with the CAS number 1137-12-8, is a bicyclic sesquiterpene hydrocarbon. It is characterized by its complex structure, which includes multiple rings and a unique arrangement of carbon atoms. Longicyclene is typically found in various essential oils and is known for its distinct aroma, contributing to the scent profiles of certain plants. This compound is often studied for its potential applications in the fragrance industry and as a natural product in perfumery. Additionally, longicyclene may exhibit biological activities, making it of interest in the field of natural product chemistry. Its stability and reactivity can vary depending on environmental conditions, such as temperature and pressure. Overall, longicyclene represents a fascinating example of the diversity found within terpenoid compounds, showcasing the intricate relationships between structure, scent, and potential applications in various industries.
Formula:C15H24
InChI:InChI=1S/C15H24/c1-13(2)6-5-7-14(3)9-8-10-12(11(9)13)15(10,14)4/h9-12H,5-8H2,1-4H3/t9-,10?,11-,12-,14+,15+/m1/s1
InChI key:InChIKey=WCEIQUQVIOGRBF-PHVFNNLASA-N
SMILES:C[C@@]12[C@@]3([C@]1(C[C@@]4([C@]3(C(C)(C)CCC[C@]24C)[H])[H])[H])[H]
Synonyms:- Longicyclene
- (1S,2R,3aR,4R,8aR,9S)-Decahydro-1,5,5,8a-tetramethyl-1,2,4-methenoazulene
- 1,2,4-Methenoazulene, decahydro-1,5,5,8a-tetramethyl-, [1S-(1α,2α,3aβ,4α,8aβ,9R*)]-
- 1,2,4-Methenoazulene, decahydro-1,5,5,8a-tetramethyl-
- 1,2,4-Methenoazulene, decahydro-1,5,5,8a-tetramethyl-, (1S,2R,3aR,4R,8aR,9S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,2,4-Methenoazulene, decahydro-1,5,5,8a-tetramethyl-, (1S,2R,3aR,4R,8aR,9S)-
CAS:Formula:C15H24Molecular weight:204.3511
