
CAS 1137-43-5
:(4-Bromophenyl)phenylmethanethione
Description:
(4-Bromophenyl)phenylmethanethione, with the CAS number 1137-43-5, is an organic compound characterized by the presence of a thioketone functional group. It features a phenyl ring substituted with a bromine atom at the para position, which influences its reactivity and physical properties. The compound is typically a solid at room temperature and may exhibit a distinct odor due to the presence of sulfur in its structure. Its molecular structure suggests potential applications in organic synthesis and as an intermediate in the production of various chemical compounds. The bromine substituent can enhance electrophilic reactivity, making it useful in further chemical transformations. Additionally, the compound may exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Safety data indicates that, like many organosulfur compounds, it should be handled with care due to potential toxicity and environmental impact. Proper storage and handling protocols are essential to mitigate risks associated with exposure.
Formula:C13H9BrS
InChI:InChI=1S/C13H9BrS/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h1-9H
InChI key:InChIKey=IRNGLAYMEIDCPU-UHFFFAOYSA-N
SMILES:C(=S)(C1=CC=C(Br)C=C1)C2=CC=CC=C2
Synonyms:- 4-Bromothiobenzophenone
- Benzophenone, 4-bromothio-
- Methanethione, (4-bromophenyl)phenyl-
- (4-Bromophenyl)phenylmethanethione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
