CAS 1137-69-5
:2-chlorophenazine
Description:
2-Chlorophenazine is an organic compound characterized by its phenazine backbone, which consists of two fused benzene rings containing nitrogen atoms. The presence of a chlorine atom at the second position of the phenazine structure significantly influences its chemical properties and reactivity. This compound typically appears as a solid, often exhibiting a yellow to brown color. It is relatively insoluble in water but may dissolve in organic solvents such as ethanol and acetone. 2-Chlorophenazine can participate in various chemical reactions, including electrophilic substitution due to the electron-withdrawing nature of the chlorine atom. It is of interest in various fields, including organic synthesis and materials science, due to its potential applications in dyes, pharmaceuticals, and as a precursor for other chemical compounds. Additionally, its biological activity has been studied, revealing potential antimicrobial and antitumor properties. As with many chlorinated compounds, safety precautions should be taken when handling 2-chlorophenazine due to its potential toxicity and environmental impact.
Formula:C12H7ClN2
InChI:InChI=1/C12H7ClN2/c13-8-5-6-11-12(7-8)15-10-4-2-1-3-9(10)14-11/h1-7H
InChI key:InChIKey=LYZDGXICDJEHAD-UHFFFAOYSA-N
SMILES:ClC1=CC2=C(N=C3C(=N2)C=CC=C3)C=C1
Synonyms:- Phenazine, 2-chloro-
- 2-Chlorophenazine
- NSC 402849
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
