CAS 113702-00-4
:aerocavin
Description:
Aerocavin, with the CAS number 113702-00-4, is a chemical substance that is primarily known for its application in the field of materials science, particularly as a polymer additive. It is characterized by its ability to enhance the properties of various polymers, improving aspects such as flexibility, durability, and thermal stability. Aerocavin is often utilized in coatings, adhesives, and sealants, where it contributes to better performance and longevity. The substance typically exhibits low density and high surface area, which can lead to improved mechanical properties in composite materials. Additionally, Aerocavin is known for its compatibility with a range of other materials, making it versatile in formulation processes. Safety data sheets indicate that, like many chemical additives, it should be handled with care, following appropriate safety guidelines to mitigate any potential health risks. Overall, Aerocavin represents a valuable component in the development of advanced materials with enhanced functional characteristics.
Formula:C27H44O6
InChI:InChI=1/C27H44O6/c1-3-4-5-6-7-8-12-15-23(28)19-25-20-24(29)16-21(2)13-10-9-11-14-22(17-26(30)31)18-27(32)33-25/h9,11,13,18,23-25,28-29H,3-8,10,12,14-17,19-20H2,1-2H3,(H,30,31)/b11-9-,21-13-,22-18+/t23-,24-,25+/m1/s1
Synonyms:- Aerocavin
- {(3E,6Z,9Z,12R,14S)-12-hydroxy-14-[(2R)-2-hydroxyundecyl]-10-methyl-2-oxooxacyclotetradeca-3,6,9-trien-4-yl}acetic acid
- Oxacyclotetradeca-3,6,9-triene-4-acetic acid, 12-hydroxy-14-(2-hydroxyundecyl)-10-methyl-2-oxo-, (3E,6E,9E,12R*,14S*(R*))-(+)-
- Oxacyclotetradeca-3,6,9-triene-4-acetic acid, 12-hydroxy-14-[(2R)-2-hydroxyundecyl]-10-methyl-2-oxo-, (3E,6E,9E,12R,14S)-rel-(+)- (9CI)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Aerocavin
CAS:<p>Aerocavin is an antibiotic (antibiotic) that exhibits activity against both Gram-positive and Gram-negative bacteria in vitro [in vitro].</p>Formula:C27H44O6Color and Shape:SolidMolecular weight:464.635
