
CAS 113707-83-8
:5-Chloro-6-methoxy-3(2H)-pyridazinone
Description:
5-Chloro-6-methoxy-3(2H)-pyridazinone is a heterocyclic organic compound characterized by its pyridazinone structure, which features a pyridazine ring with a ketone and an amine functional group. The presence of a chlorine atom at the 5-position and a methoxy group at the 6-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar organic solvents. It may exhibit biological activity, making it of interest in pharmaceutical research. The molecular structure suggests potential reactivity due to the presence of the chlorine and methoxy substituents, which can influence its interaction with other chemical species. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. As with many heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C5H5ClN2O2
InChI:InChI=1S/C5H5ClN2O2/c1-10-5-3(6)2-4(9)7-8-5/h2H,1H3,(H,7,9)
InChI key:InChIKey=BVOOQZSELPHHBB-UHFFFAOYSA-N
SMILES:O(C)C=1C(Cl)=CC(=O)NN1
Synonyms:- 5-Chloro-6-methoxy-3(2H)-pyridazinone
- 3(2H)-Pyridazinone, 5-chloro-6-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
