CAS 113708-05-7
:5-(4,6-Dimethyl-2-pyridinyl)pyrimidine
Description:
5-(4,6-Dimethyl-2-pyridinyl)pyrimidine, with the CAS number 113708-05-7, is a heterocyclic organic compound characterized by its pyrimidine and pyridine moieties. This compound features a pyrimidine ring, which is a six-membered ring containing two nitrogen atoms at positions 1 and 3, and is substituted with a 4,6-dimethyl-2-pyridinyl group. The presence of the dimethyl groups enhances its lipophilicity and may influence its biological activity. Typically, compounds of this nature are of interest in medicinal chemistry due to their potential as pharmaceuticals or agrochemicals. They may exhibit various biological activities, including antimicrobial, anti-inflammatory, or anticancer properties, depending on their specific structure and substituents. The compound's solubility, stability, and reactivity can vary based on its functional groups and the overall molecular structure. As with many heterocycles, it may also participate in various chemical reactions, making it a versatile building block in organic synthesis.
Formula:C11H11N3
InChI:InChI=1S/C11H11N3/c1-8-3-9(2)14-11(4-8)10-5-12-7-13-6-10/h3-7H,1-2H3
InChI key:InChIKey=LLGFEQDXNSROIA-UHFFFAOYSA-N
SMILES:CC=1C=C(N=C(C)C1)C=2C=NC=NC2
Synonyms:- Pyrimidine, 5-(4,6-dimethyl-2-pyridinyl)-
- 5-(4,6-Dimethyl-2-pyridinyl)pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
