CymitQuimica logo

CAS 113732-77-7

:

α-(Aminomethyl)-2-methyl-4-thiazolemethanol

Description:
α-(Aminomethyl)-2-methyl-4-thiazolemethanol, with the CAS number 113732-77-7, is a chemical compound characterized by its thiazole ring structure, which contributes to its biological activity. This compound features an aminomethyl group and a hydroxymethyl group, enhancing its potential for interaction with biological targets. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of hydroxyl and amino functional groups. The thiazole moiety often imparts unique properties, such as antimicrobial or antifungal activity, making it of interest in pharmaceutical research. Additionally, the compound's structure suggests potential for hydrogen bonding, influencing its reactivity and interactions in various chemical environments. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices. Overall, α-(Aminomethyl)-2-methyl-4-thiazolemethanol represents a class of compounds with significant implications in medicinal chemistry and biochemistry.
Formula:C6H10N2OS
InChI:InChI=1S/C6H10N2OS/c1-4-8-5(3-10-4)6(9)2-7/h3,6,9H,2,7H2,1H3
InChI key:InChIKey=KGPRDNIYQACYJQ-UHFFFAOYSA-N
SMILES:C(CN)(O)C=1N=C(C)SC1
Synonyms:
  • α-(Aminomethyl)-2-methyl-4-thiazolemethanol
  • 2-Amino-1-(2-methyl-1,3-thiazol-4-yl)ethanol
  • 2-Amino-1-(2-methyl-1,3-thiazol-4-yl)ethan-1-ol
  • 4-Thiazolemethanol, α-(aminomethyl)-2-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.