CAS 113732-84-6: 2-Methyloxazole-4-carbaldehyde

Description:2-Methyloxazole-4-carbaldehyde is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a methyl group at the second position and an aldehyde functional group at the fourth position of the oxazole ring. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the aldehyde group makes it reactive, particularly in condensation reactions and as a potential electrophile in various organic syntheses. 2-Methyloxazole-4-carbaldehyde is of interest in the field of medicinal chemistry and material science due to its potential applications in the synthesis of pharmaceuticals and agrochemicals. Its properties, such as solubility and stability, can vary based on the solvent and environmental conditions. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if inhaled or ingested.

Formula:C₅H₅NO₂

InChI:InChI=1/C5H5NO2/c1-4-6-5(2-7)3-8-4/h2-3H,1H3

Synonyms:
2-Methyl-Oxazole-4-Carbaldehyde
2-Methyl-1,3-Oxazole-4-Carbaldehyde
2-Methyl-4-Formyloxazole
2-Methyl-1,3-oxazole-4-carboxaldehyde
2-Methyl-4-oxazolecarboxaldehyde
2-Methyloxazole-4-carboxaldehyde
2-Methyl-1,3-Oxazole-4-Carboxylic Acid

Found 4 products.

Product data	Purity	Price range	Estimated delivery
4-Oxazolecarboxaldehyde, 2-methyl- REF: IN-DA0009GWCAS: 113732-84-6	97%	To inquire	Tue 04 Mar 25
2-Methyl-1,3-oxazole-4-carboxaldehyde REF: 54-OR17528CAS: 113732-84-6	0.99	71.00 €~1,292.00 €	Mon 03 Mar 25
2-Methyl-oxazole-4-carbaldehyde REF: 10-F037254CAS: 113732-84-6	98.0%	17.00 €~439.00 €	Wed 05 Mar 25
2-Methyl-Oxazole-4-carbaldehyde REF: 3D-FM51473CAS: 113732-84-6	Min. 95%	- - -	Discontinued product