
CAS 1137339-99-1
:B-[5-(Acetylamino)-2-methoxyphenyl]boronic acid
Description:
B-[5-(Acetylamino)-2-methoxyphenyl]boronic acid is an organic compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and organic synthesis. The compound features an acetylamino group, which enhances its solubility and reactivity, and a methoxy group that can influence its electronic properties and steric hindrance. Typically, boronic acids are utilized in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. The presence of the aromatic ring contributes to the compound's stability and potential for further functionalization. Additionally, the specific arrangement of substituents on the phenyl ring can affect the compound's biological activity and interaction with other molecules. Overall, B-[5-(Acetylamino)-2-methoxyphenyl]boronic acid represents a versatile building block in chemical research and development, particularly in the fields of pharmaceuticals and materials science.
Formula:C9H12BNO4
InChI:InChI=1S/C9H12BNO4/c1-6(12)11-7-3-4-9(15-2)8(5-7)10(13)14/h3-5,13-14H,1-2H3,(H,11,12)
InChI key:InChIKey=XSPLOLPFXRODNU-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(OC)C=CC(NC(C)=O)=C1
Synonyms:- Boronic acid, B-[5-(acetylamino)-2-methoxyphenyl]-
- B-[5-(Acetylamino)-2-methoxyphenyl]boronic acid
- (5-Acetamido-2-methoxyphenyl)boronic acid
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery