CAS 113740-61-7
:2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]acetic acid
Description:
2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]acetic acid, with the CAS number 113740-61-7, is a chemical compound characterized by its complex structure, which includes a piperazine ring and an acetic acid moiety. This compound typically exhibits properties associated with both basic and acidic functional groups, allowing it to participate in various chemical reactions. It is often studied for its potential pharmacological applications, particularly in the field of medicinal chemistry, where it may exhibit activity related to neurotransmitter modulation. The presence of the 4-chlorophenyl group suggests potential interactions with biological targets, making it of interest in drug development. Additionally, its solubility and stability can vary based on environmental conditions, such as pH and temperature. Overall, this compound represents a class of molecules that may have significant implications in therapeutic contexts, particularly in the treatment of psychiatric or neurological disorders. Further research is necessary to fully elucidate its biological activity and potential applications.
Formula:C19H21ClN2O2
InChI:InChI=1S/C19H21ClN2O2/c20-17-8-6-16(7-9-17)19(15-4-2-1-3-5-15)22-12-10-21(11-13-22)14-18(23)24/h1-9,19H,10-14H2,(H,23,24)
InChI key:NBQBQRKLQXVPIS-UHFFFAOYSA-N
SMILES:C1CN(CCN1CC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl
Synonyms:- Cetirizine acetic acid
- Unii-8Ao4Aeb0V4
- De(carboxymethoxy) Cetirizine Acetic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-(4-((4-Chlorophenyl)(phenyl)methyl)piperazin-1-yl)acetic acid
CAS:2-(4-((4-Chlorophenyl)(phenyl)methyl)piperazin-1-yl)acetic acidFormula:C19H21ClN2O2Purity:98%Molecular weight:344.842-(4-((4-Chlorophenyl)(phenyl)methyl)piperazin-1-yl)acetic acid
CAS:2-(4-((4-Chlorophenyl)(phenyl)methyl)piperazin-1-yl)acetic acidFormula:C19H21ClN2O2Purity:98%Molecular weight:344.84Cetirizine Impurity B
CAS:Cetirizine Impurity B is a custom synthesis impurity. It is a product of the metabolism of cetirizine, an anti-allergic drug. Cetirizine Impurity B is used as an impurity standard for drug development and analytical HPLC studies. It has been assigned CAS number 113740-61-7 by the Chemical Abstracts Service. The purity of this compound is greater than 99%.
Formula:C19H21ClN2O2Purity:Min. 90 Area-%Color and Shape:PowderMolecular weight:344.8 g/molCetirizine Acetic Acid (4-[(4-Chlorophenyl)phenylmethyl]-1-piperazineacetic acid; 2-{4-[(4-Chlorophenyl)phenylmethyl]piperazin-1-yl}acetic acid) (DISCONTINUED)
CAS:Compounds containing a pyrimidine ring, whether or not hydrogenated, or piperazine ring in the structure, nesoiFormula:C19H21ClN2O2Color and Shape:White Off-White SolidMolecular weight:344.12916





