CAS 113741-01-8
:2-(2-METHYL-IMIDAZOL-1-YL)-ETHYLAMINE 2HCL
Description:
2-(2-Methyl-imidazol-1-yl)-ethylamine 2HCl is a chemical compound characterized by its imidazole ring structure, which contributes to its biological activity and potential applications in pharmaceuticals. The presence of the ethylamine group enhances its solubility and reactivity, making it suitable for various chemical reactions. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form. This compound may exhibit properties such as being a potential ligand in coordination chemistry or acting as a building block in the synthesis of more complex molecules. Its structure suggests possible interactions with biological systems, which could lead to applications in drug development or as a biochemical probe. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed. Overall, 2-(2-Methyl-imidazol-1-yl)-ethylamine 2HCl is of interest in both synthetic and medicinal chemistry due to its unique structural features.
Formula:C6H11N3
InChI:InChI=1/C6H11N3/c1-6-8-3-5-9(6)4-2-7/h3,5H,2,4,7H2,1H3
SMILES:Cc1nccn1CCN
Synonyms:- [2-(2-Methyl-1H-Imidazol-1-Yl)Ethyl]Amine Dihydrochloride
- 2-(2-Methylimidazolyl)Ethylamine Dihydrochloride
- 2-Methyl-1H-Imidazole-1-Ethylamine
- 2-(2-methyl-1H-imidazol-1-yl)ethanamine
- 2-(2-methyl-1H-imidazol-1-yl)ethanamine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(2-Methyl-1H-imidazol-1-yl)ethanamine
CAS:Formula:C6H11N3Color and Shape:SolidMolecular weight:125.1716
