CymitQuimica logo

CAS 113759-96-9

:

1-(4-CHLORO-PHENYL)-PIPERIDIN-4-ONE

Description:
1-(4-Chloro-phenyl)-piperidin-4-one, with the CAS number 113759-96-9, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. The presence of a 4-chlorophenyl group indicates that a chlorine atom is substituted on the phenyl ring at the para position, influencing the compound's reactivity and biological activity. This compound typically exhibits properties associated with piperidine derivatives, such as potential psychoactive effects and interactions with various biological targets. It may be utilized in medicinal chemistry for the development of pharmaceuticals, particularly in the context of neuropharmacology. The compound's molecular structure suggests it may participate in hydrogen bonding and exhibit lipophilicity, which can affect its solubility and permeability in biological systems. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or environmental impact. Further studies would be necessary to fully elucidate its pharmacological properties and applications.
Formula:C11H12ClNO
InChI:InChI=1/C11H12ClNO/c12-9-1-3-10(4-2-9)13-7-5-11(14)6-8-13/h1-4H,5-8H2
InChI key:SUPUBCWGOUYLIG-UHFFFAOYSA-N
SMILES:c1cc(ccc1Cl)N1CCC(=O)CC1
Synonyms:
  • Chembrdg-Bb 4000323
Found 4 products.