CymitQuimica logo

CAS 113765-56-3

:

4-Methyl-2-(2-methylphenyl)-1,3,2-dioxaborolane

Description:
4-Methyl-2-(2-methylphenyl)-1,3,2-dioxaborolane is an organoboron compound characterized by its dioxaborolane ring structure, which features a boron atom bonded to two oxygen atoms and a carbon framework. This compound typically exhibits a colorless to pale yellow appearance and is soluble in organic solvents, making it useful in various chemical applications. The presence of the methyl and 2-methylphenyl substituents contributes to its unique reactivity and potential as a building block in organic synthesis, particularly in the formation of carbon-boron bonds. It may also serve as a reagent in cross-coupling reactions, which are essential in the synthesis of complex organic molecules. Additionally, the compound's boron content can impart interesting properties, such as the ability to act as a Lewis acid, facilitating various chemical transformations. Safety data should be consulted for handling and storage, as organoboron compounds can exhibit varying degrees of toxicity and reactivity. Overall, 4-Methyl-2-(2-methylphenyl)-1,3,2-dioxaborolane is a valuable compound in the field of organic chemistry.
Formula:C10H13BO2
InChI:InChI=1S/C10H13BO2/c1-8-5-3-4-6-10(8)11-12-7-9(2)13-11/h3-6,9H,7H2,1-2H3
InChI key:InChIKey=SVRGNMLYRLOJLM-UHFFFAOYSA-N
SMILES:CC1=C(C=CC=C1)B2OC(C)CO2
Synonyms:
  • 1,3,2-Dioxaborolane, 4-methyl-2-(2-methylphenyl)-
  • 4-Methyl-2-(2-methylphenyl)-1,3,2-dioxaborolane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.