CymitQuimica logo

CAS 113770-79-9

:

(9Z,12Z)-N-(2,4,6-Trimethoxyphenyl)-9,12-octadecadienamide

Description:
(9Z,12Z)-N-(2,4,6-Trimethoxyphenyl)-9,12-octadecadienamide, with CAS number 113770-79-9, is a synthetic compound characterized by its long carbon chain structure and specific geometric configuration of double bonds. This molecule features a fatty acid amide backbone, which contributes to its potential biological activity. The presence of the 2,4,6-trimethoxyphenyl group enhances its lipophilicity, potentially influencing its interaction with biological membranes and receptors. The (9Z,12Z) configuration indicates that the double bonds are in the cis form, which can affect the compound's physical properties, such as melting point and solubility. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential applications in areas such as anti-inflammatory or anticancer research, although specific biological activities would require further investigation. Overall, the characteristics of this compound suggest it may play a role in various biochemical processes, warranting further study to elucidate its mechanisms of action.
Formula:C27H43NO4
InChI:InChI=1S/C27H43NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-26(29)28-27-24(31-3)21-23(30-2)22-25(27)32-4/h9-10,12-13,21-22H,5-8,11,14-20H2,1-4H3,(H,28,29)/b10-9-,13-12-
InChI key:InChIKey=CRXKCRSMQFBUEB-UTJQPWESSA-N
SMILES:N(C(CCCCCCC/C=C\C/C=C\CCCCC)=O)C1=C(OC)C=C(OC)C=C1OC
Synonyms:
  • 9,12-Octadecadienamide, N-(2,4,6-trimethoxyphenyl)-, (9Z,12Z)-
  • (9Z,12Z)-N-(2,4,6-Trimethoxyphenyl)-9,12-octadecadienamide
  • 9,12-Octadecadienamide, N-(2,4,6-trimethoxyphenyl)-, (Z,Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.