CAS 113772-12-6
:2-AMINO-1-(4-METHOXYBENZYL)-4,5,6,7-TETRAHYDRO-1H-INDOLE-3-CARBONITRILE
Description:
2-Amino-1-(4-methoxybenzyl)-4,5,6,7-tetrahydro-1H-indole-3-carbonitrile is a chemical compound characterized by its complex structure, which includes an indole core, a carbonitrile functional group, and an amino group. The presence of the methoxybenzyl substituent enhances its lipophilicity and may influence its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric disorders, given the indole's association with serotonin receptors. The carbonitrile group may also contribute to its reactivity and potential as a building block in organic synthesis. Safety data for this compound should be consulted, as it may pose hazards typical of organic nitriles and amines, including toxicity and irritant properties. Overall, 2-amino-1-(4-methoxybenzyl)-4,5,6,7-tetrahydro-1H-indole-3-carbonitrile represents a compound of interest for further research in various chemical and biological contexts.
Formula:C17H19N3O
InChI:InChI=1/C17H19N3O/c1-21-13-8-6-12(7-9-13)11-20-16-5-3-2-4-14(16)15(10-18)17(20)19/h6-9H,2-5,11,19H2,1H3
SMILES:COc1ccc(cc1)Cn1c2CCCCc2c(C#N)c1N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Amino-1-(4-methoxybenzyl)-4,5,6,7-tetrahydro-1H-indole-3-carbonitrile
CAS:Formula:C17H19N3OColor and Shape:SolidMolecular weight:281.3523
