CAS 113772-14-8
:1H-Indole-3-carboxylicacid,2-amino-,methylester(9CI)
Description:
1H-Indole-3-carboxylic acid, 2-amino-, methyl ester, also known by its CAS number 113772-14-8, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a carboxylic acid group and an amino group, contributing to its potential biological activity. The methyl ester form indicates that the carboxylic acid is esterified with a methyl group, which can influence its solubility and reactivity. Typically, compounds of this nature are studied for their roles in pharmaceuticals and biochemistry, particularly due to the indole moiety's prevalence in various natural products and its importance in medicinal chemistry. The presence of both the amino and carboxylic acid functional groups suggests potential for hydrogen bonding and interactions with biological targets. Overall, this compound may exhibit interesting properties that warrant further investigation in the context of drug development and biochemical applications.
Formula:C10H10N2O2
InChI:InChI=1/C10H10N2O2/c1-14-10(13)8-6-4-2-3-5-7(6)12-9(8)11/h2-5,12H,11H2,1H3
SMILES:COC(=O)c1c2ccccc2[nH]c1N
Synonyms:- methyl 2-amino-1H-indole-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
