CAS 113775-22-7

BOC-4-HYDROXY-L-PYRROLIDINE LACTONE

Description:

BOC-4-Hydroxy-L-pyrrolidine lactone, identified by its CAS number 113775-22-7, is a chemical compound characterized by its lactone structure derived from pyrrolidine. It features a tert-butyloxycarbonyl (BOC) protecting group, which is commonly used in organic synthesis to protect amines during chemical reactions. The compound is typically a white to off-white solid and is soluble in organic solvents such as dichloromethane and dimethyl sulfoxide (DMSO). Its molecular structure includes a pyrrolidine ring with a hydroxyl group at the 4-position, contributing to its reactivity and potential applications in medicinal chemistry, particularly in the synthesis of pharmaceuticals. The BOC group can be removed under acidic conditions, allowing for the regeneration of the free amine. This compound is often utilized in peptide synthesis and other organic transformations, making it valuable in the development of biologically active molecules. As with many chemical substances, proper handling and safety precautions should be observed due to potential hazards associated with its use.

Formula: C₁₀H₁₅NO₄

InChI: InChI=1/C10H15NO4/c1-10(2,3)15-9(13)11-5-6-4-7(11)8(12)14-6/h6-7H,4-5H2,1-3H3/t6-,7-/m0/s1

SMILES: CC(C)(C)OC(=O)N1C[C@@H]2C[C@H]1C(=O)O2

Synonyms:

• N-T-Boc-4-Hydroxy-L-Pyrrolidine Lactone
• tert-butyl (1S,4S)-3-oxo-2-oxa-5-azabicyclo[2.2.1]heptane-5-carboxylate

2-Oxa-5-azabicyclo[2.2.1]heptane-5-carboxylic acid, 3-oxo-, 1,1-dimethylethyl ester, (1S,4S)-

CAS: 113775-22-7

Formula: C₁₀H₁₅NO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 213.2304

Ref: IN-DA0009NN

N-t-BOC-4-Hydroxy-L-Pyrrolidine Lactone

CAS: 113775-22-7

N-t-BOC-4-Hydroxy-L-Pyrrolidine Lactone

Purity: 97%

Molecular weight: 213.23g/mol

Ref: 54-OR316002

(1S,4S)-tert-Butyl 3-oxo-2-oxa-5-azabicyclo[2.2.1]heptane-5-carboxylate

CAS: 113775-22-7

Formula: C₁₀H₁₅NO₄

Purity: 95%

Molecular weight: 213.233

Ref: 10-F210831