CAS 113777-33-6
:8-[4-(1,4-BENZODIOXAN-2-YLMETHYLAMINO)BUTYL]-8-AZASPIRO[4.5]DECANE-7,9-DIONE HYDROCHLORIDE
Description:
The chemical substance known as 8-[4-(1,4-benzodioxan-2-ylmethylamino)butyl]-8-azaspiro[4.5]decane-7,9-dione hydrochloride, with CAS number 113777-33-6, is a synthetic compound that belongs to the class of spirocyclic compounds. It features a complex molecular structure characterized by a spirodecane framework, which is fused with a dione functional group and an amine side chain. The presence of the benzodioxan moiety suggests potential interactions with biological targets, particularly in the central nervous system, as benzodioxan derivatives are often associated with psychoactive properties. The hydrochloride salt form indicates that the compound is likely to be more soluble in water, enhancing its bioavailability for pharmacological applications. Its specific characteristics, such as melting point, solubility, and stability, would depend on the precise molecular interactions and the environment in which it is studied. Overall, this compound may have implications in medicinal chemistry, particularly in the development of novel therapeutic agents.
Formula:C22H30N2O4
InChI:InChI=1/C22H30N2O4/c25-20-13-22(9-3-4-10-22)14-21(26)24(20)12-6-5-11-23-15-17-16-27-18-7-1-2-8-19(18)28-17/h1-2,7-8,17,23H,3-6,9-16H2
SMILES:c1ccc2c(c1)OCC(CNCCCCN1C(=O)CC3(CCCC3)CC1=O)O2
Synonyms:- Mdl 72832 Hydrochloride
- MDL72832HCl
- Mdl 72832
- 8-{4-[(2,3-Dihydro-1,4-Benzodioxin-2-Ylmethyl)Amino]Butyl}-8-Azaspiro[4.5]Decane-7,9-Dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
8-Azaspiro[4.5]decane-7,9-dione, 8-[4-[[(2,3-dihydro-1,4-benzodioxin-2-yl)methyl]amino]butyl]-
CAS:Formula:C22H30N2O4Molecular weight:386.4846
