CAS 113779-23-0
:4-amino-2-fluorobut-2-enoic acid
Description:
4-Amino-2-fluorobut-2-enoic acid, with the CAS number 113779-23-0, is an organic compound characterized by the presence of an amino group, a fluorine atom, and a double bond within its butenoic acid structure. This compound features a four-carbon backbone with a double bond between the second and third carbons, which contributes to its reactivity and potential applications in organic synthesis. The amino group (-NH2) is typically associated with basic properties, while the carboxylic acid group (-COOH) imparts acidic characteristics. The presence of the fluorine atom can enhance the compound's biological activity and influence its solubility and stability. 4-Amino-2-fluorobut-2-enoic acid may be of interest in pharmaceutical research and development due to its potential as a building block for more complex molecules or as a bioactive agent. Its unique structural features make it a subject of study in various fields, including medicinal chemistry and materials science.
Formula:C4H6FNO2
InChI:InChI=1/C4H6FNO2/c5-3(1-2-6)4(7)8/h1H,2,6H2,(H,7,8)/b3-1-
SMILES:C(=C(\C(=O)O)/F)/CN
Synonyms:- (Z)-4-Amino-2-fluorobut-2-enoic acid
- 4-Afbea
- (2Z)-4-amino-2-fluorobut-2-enoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
