CAS 113785-48-1
:RM 49
Description:
RM 49, with the CAS number 113785-48-1, is a chemical compound primarily recognized as a herbicide. It belongs to the class of substances known as sulfonylureas, which are commonly used in agricultural practices to control a variety of weeds. The compound functions by inhibiting specific enzymes involved in the biosynthesis of amino acids, thereby disrupting the growth of target plants. RM 49 is typically characterized by its selective action, allowing it to target certain weed species while minimizing harm to crops. It is often applied in pre-emergent or post-emergent stages of plant growth. The substance is generally considered to have low toxicity to mammals, but like many agrochemicals, it requires careful handling and application to mitigate environmental impact and ensure safety. Additionally, its effectiveness can be influenced by factors such as soil type, weather conditions, and the presence of other chemicals. As with all herbicides, adherence to recommended usage guidelines is crucial for optimal results and environmental protection.
Formula:C16H20N4O6
InChI:InChI=1/C16H20N4O6/c1-6-10(19-23)12(21)9-7(5-26-15(17)22)16(25-3)14-8(18-14)4-20(16)11(9)13(6)24-2/h7-8,14,18,21H,4-5H2,1-3H3,(H2,17,22)/t7-,8-,14-,16-/m0/s1
Synonyms:- 8-((Aminocarbonyl)oxy)methyl-4,8a-dimethoxy-1,1a,2,8,8a,8b-hexahydro-7-hydroxy-5-methyl-6-nitrosoazirino(2',3'-3,4)-pyrrolo-(1,2-a)indole
- Azirino(2',3':3,4)pyrrolo(1,2-a)indole-8-methanol, 1,1a,2,8,8a,8b-hexahydro-7-hydroxy-4,8a-dimethoxy-5-methyl-6-nitroso-, alpha-carbamate, (1aS-(1aalpha,8beta,8aalpha,8balpha))-
- [(1aS,8R,8aS,8bS)-7-hydroxy-4,8a-dimethoxy-5-methyl-6-nitroso-1,1a,2,8,8a,8b-hexahydroazireno[2',3':3,4]pyrrolo[1,2-a]indol-8-yl]methyl carbamate
- RM-49
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Azirino[2',3':3,4]pyrrolo[1,2-a]indole-8-methanol, 1,1a,2,8,8a,8b-hexahydro-7-hydroxy-4,8a-dimethoxy-5-methyl-6-nitroso-, α-carbamate, (1aS,8S,8aR,8bS)- (9CI)
CAS:Formula:C16H20N4O6Molecular weight:364.3532RM 49
CAS:RM 49 is a mitomycin C derivative that has antitumor activity in vitro.Formula:C16H20N4O6Purity:98%Color and Shape:SolidMolecular weight:364.35

