CAS 113786-33-7
:BOPTA
Description:
BOPTA, or bis(2,6-dioxopiperidin-3-yl)amine, is a chemical compound primarily recognized for its application in the field of radiopharmaceuticals, particularly as a chelating agent for metal ions in imaging and therapeutic procedures. It features a piperidine ring structure, which contributes to its ability to form stable complexes with various metal ions, including those used in medical imaging. BOPTA is characterized by its high stability and selectivity, making it suitable for use in diagnostic imaging techniques such as MRI and PET scans. Additionally, its solubility in organic solvents and moderate water solubility enhance its utility in biological systems. The compound is typically handled with care due to its potential biological activity, and its synthesis involves multi-step organic reactions. As with many chemical substances, safety data sheets should be consulted for handling and disposal guidelines to mitigate any risks associated with its use.
Formula:C22H31N3O11
InChI:InChI=1S/C22H31N3O11/c26-18(27)10-23(6-7-24(11-19(28)29)12-20(30)31)8-9-25(13-21(32)33)17(22(34)35)15-36-14-16-4-2-1-3-5-16/h1-5,17H,6-15H2,(H,26,27)(H,28,29)(H,30,31)(H,32,33)(H,34,35)
InChI key:InChIKey=OEIYJWYTUDFZBH-UHFFFAOYSA-N
SMILES:N(C(COCC1=CC=CC=C1)C(O)=O)(CCN(CCN(CC(O)=O)CC(O)=O)CC(O)=O)CC(O)=O
Synonyms:- 4-Carboxy-5,8,11-tris(carboxymethyl)-1-phenyl-2-oxa-5,8,11-triazatridecan-13-oic acid
- 2-Oxa-5,8,11-triazatridecan-13-oic acid, 4-carboxy-5,8,11-tris(carboxymethyl)-1-phenyl-
- B 19036
- 12-Oxa-3,6,9-triazatridecanoic acid, 10-carboxy-3,6,9-tris(carboxymethyl)-13-phenyl-
- BOPTA
- 10-Carboxy-3,6,9-tris(carboxymethyl)-13-phenyl-12-oxa-3,6,9-triazatridecanoic acid
- Gadobenate Dimeglumine Impurity 5
- 2,2''-(1,9-Dicarboxy-2-(carboxymethyl)-12-phenyl-11-oxa-2,5,8-triazadodecane-5,8-diyl)diacetic Acid
- Febuxostat Impurity 136
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,2'-(1,9-Dicarboxy-2-(carboxymethyl)-12-phenyl-11-oxa-2,5,8-triazadodecane-5,8-diyl)diacetic Acid
CAS:Formula:C22H31N3O11Molecular weight:513.5
