CAS 1137869-93-2: 3-Fluoro-5-methoxy-4-nitrobenzoic acid
Description:3-Fluoro-5-methoxy-4-nitrobenzoic acid is an aromatic compound characterized by the presence of a benzoic acid structure substituted with a fluorine atom, a methoxy group, and a nitro group. The fluorine atom is located at the meta position relative to the carboxylic acid group, while the methoxy and nitro groups are positioned at the para and ortho positions, respectively. This compound exhibits both acidic and polar characteristics due to the carboxylic acid functional group and the presence of electronegative substituents, which can influence its reactivity and solubility in various solvents. The nitro group contributes to its electron-withdrawing properties, potentially enhancing its reactivity in electrophilic substitution reactions. Additionally, the methoxy group can provide some degree of electron donation through resonance, affecting the overall electronic distribution within the molecule. This compound may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, owing to its unique structural features and functional groups.
Formula:C8H6FNO5
InChI:InChI=1S/C8H6FNO5/c1-15-6-3-4(8(11)12)2-5(9)7(6)10(13)14/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=PXQRXFVLYSGNEL-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC(F)=C(C(OC)=C1)N(=O)=O
- Synonyms:
- Benzoic acid, 3-fluoro-5-methoxy-4-nitro-
- 3-Fluoro-5-methoxy-4-nitrobenzoic acid
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 3-Fluoro-5-methoxy-4-nitrobenzoic acid REF: 54-PC100831CAS: 1137869-93-2 | 0.95 | 347.00 €~4,081.00 € | Tue 04 Mar 25 |
 | 3-Fluoro-5-methoxy-4-nitrobenzoic acid REF: 10-F621307CAS: 1137869-93-2 | 98% | 183.00 €~11,895.00 € | Thu 06 Mar 25 |
 | 3-fluoro-5-methoxy-4-nitrobenzoic acid REF: IN-DA0091OKCAS: 1137869-93-2 | 95% | - - - | Discontinued product |
 | 3-Fluoro-5-methoxy-4-nitrobenzoic acid REF: 3D-MVB86993CAS: 1137869-93-2 | Min. 95% | - - - | Discontinued product |
Ref: 54-PC100831
| 1g | 1,442.00 € | ||
| 5g | 4,081.00 € | ||
| 2.5g | 2,721.00 € | ||
| 50mg | 347.00 € | ||
| 100mg | 429.00 € | ||
| 250mg | 697.00 € |
Ref: 10-F621307
| 1g | 786.00 € | ||
| 5g | 2,714.00 € | ||
| 2.5g | 1,387.00 € | ||
| 50mg | 183.00 € | ||
| 100mg | 230.00 € | ||
| 250mg | 353.00 € |
3-fluoro-5-methoxy-4-nitrobenzoic acid
Ref: IN-DA0091OK
| 1g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information |
3-Fluoro-5-methoxy-4-nitrobenzoic acid
Ref: 3D-MVB86993
| 1g | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
