CAS 113793-31-0

(2S,3R)-3-HYDROXY-2-{[(4-METHOXYPHENYL)SULFONYL]AMINO}BUTANOIC ACID

Description:

(2S,3R)-3-Hydroxy-2-{[(4-methoxyphenyl)sulfonyl]amino}butanoic acid, with CAS number 113793-31-0, is a chiral amino acid derivative characterized by the presence of a hydroxyl group and a sulfonamide functional group. This compound features a butanoic acid backbone, which contributes to its acidic properties. The specific stereochemistry indicated by the (2S,3R) configuration suggests that it has distinct spatial arrangements that can influence its biological activity and interactions. The presence of the 4-methoxyphenyl group enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its sulfonamide moiety can also play a role in enzyme inhibition or modulation, which is relevant in therapeutic contexts. Overall, the unique structural features of this compound contribute to its potential applications in pharmaceuticals and biochemistry.

Formula: C₁₁H₁₅NO₆S

InChI: InChI=1/C11H15NO6S/c1-7(13)10(11(14)15)12-19(16,17)9-5-3-8(18-2)4-6-9/h3-7,10,12-13H,1-2H3,(H,14,15)

SMILES: CC(C(C(=O)O)NS(=O)(=O)c1ccc(cc1)OC)O

Synonyms:

• (2R,3S)-3-hydroxy-2-{[(4-methoxyphenyl)sulfonyl]amino}butanoate
• N-[(4-methoxyphenyl)sulfonyl]threonine

(2S,3R)-3-hydroxy-2-(4-methoxybenzenesulfonamido)butanoic acid

CAS: 113793-31-0

Formula: C₁₁H₁₅NO₆S

Molecular weight: 289.3049

Ref: IN-DA0009PK

3-Hydroxy-2-(4-methoxybenzenesulfonamido)butanoic acid

CAS: 113793-31-0

3-Hydroxy-2-(4-methoxybenzenesulfonamido)butanoic acid is a sulfonamide that has geometric properties. It contains chains and hydrogen bonds, which are formed by the torsion of the benzene ring, the coplanarity of the benzene ring, and the 3-hydroxyl group. The sulfonamide group is attached to the carbon atom in the center of this molecule, while a carbonyl group is attached to one end. This molecule also contains two benzene rings that are not directly connected. The other end of this molecule has an amine group with a hydrogen bond to a hydroxyl group from another molecule.

Formula: C₁₁H₁₅NO₆S

Purity: Min. 95%

Molecular weight: 289.31 g/mol

Ref: 3D-NEA79331