CAS 1137949-75-7

Pyridine, 5-fluoro-2-(4-piperidinyl)-, hydrochloride (1:2)

Description:

Pyridine, 5-fluoro-2-(4-piperidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a fluorine atom at the 5-position and a piperidine moiety at the 2-position contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. This compound may exhibit properties such as being a potential ligand in medicinal chemistry, with implications in drug design and development. Its structure suggests possible interactions with biological targets, making it of interest in the study of neuropharmacology or other therapeutic areas. Safety and handling precautions should be observed, as with many nitrogen-containing heterocycles, due to potential toxicity or reactivity. Overall, this compound represents a significant class of organic molecules with diverse applications in research and industry.

Formula: C₁₀H₁₃FN₂·2ClH

InChI: InChI=1S/C10H13FN2.2ClH/c11-9-1-2-10(13-7-9)8-3-5-12-6-4-8;;/h1-2,7-8,12H,3-6H2;2*1H

InChI key: InChIKey=OFROHJQGNPWPHL-UHFFFAOYSA-N

SMILES: FC1=CC=C(N=C1)C2CCNCC2.Cl

Synonyms:

• Pyridine, 5-fluoro-2-(4-piperidinyl)-, hydrochloride (1:2)

5-Fluoro-2-(piperidin-4-yl)pyridine dihydrochloride

CAS: 1137949-75-7

Versatile small molecule scaffold

Formula: C₁₀H₁₅Cl₂FN₂

Purity: Min. 95%

Molecular weight: 253.14 g/mol

Ref: 3D-MVB94975