CAS 1137950-30-1

Pyridine, 2-fluoro-5-(4-piperidinyl)-, hydrochloride (1:1)

Description:

Pyridine, 2-fluoro-5-(4-piperidinyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a fluorine atom at the 2-position and a piperidine moiety at the 5-position contributes to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents. This compound may exhibit biological activity, potentially acting as a pharmacological agent, although specific applications would depend on its interaction with biological targets. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-withdrawing nature of the fluorine atom. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, its characteristics make it of interest in both synthetic chemistry and medicinal chemistry research.

Formula: C₁₀H₁₃FN₂·ClH

InChI: InChI=1S/C10H13FN2.ClH/c11-10-2-1-9(7-13-10)8-3-5-12-6-4-8;/h1-2,7-8,12H,3-6H2;1H

InChI key: InChIKey=FVGXHLPORGIWDG-UHFFFAOYSA-N

SMILES: FC=1C=CC(=CN1)C2CCNCC2.Cl

Synonyms:

• 2-Fluoro-5-(piperidin-4-yl)pyridine hydrochloride
• Pyridine, 2-fluoro-5-(4-piperidinyl)-, hydrochloride (1:1)
• 2-Fluoro-5-(piperidin-4-yl)pyridine monohydrochloride