CymitQuimica logo

CAS 113798-80-4

:

1,4-Dioxaspiro[4.5]decane-2-methanol, (R)-

Description:
1,4-Dioxaspiro[4.5]decane-2-methanol, (R)-, is a chemical compound characterized by its unique spirocyclic structure, which includes a dioxane moiety and a methanol functional group. This compound features a bicyclic framework that contributes to its rigidity and potential stereochemical properties, as indicated by the (R)- designation, which refers to its specific chiral configuration. The presence of the hydroxymethyl group enhances its solubility in polar solvents and may influence its reactivity and interactions in various chemical environments. 1,4-Dioxaspiro[4.5]decane-2-methanol is of interest in synthetic organic chemistry and may have applications in medicinal chemistry due to its structural complexity and potential biological activity. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, this compound exemplifies the intriguing chemistry associated with spiro compounds and their derivatives.
Formula:C9H16O3
InChI:InChI=1S/C9H16O3/c10-6-8-7-11-9(12-8)4-2-1-3-5-9/h8,10H,1-7H2/t8-/m1/s1
InChI key:XUGYZVQSZWPABZ-MRVPVSSYSA-N
SMILES:C1CCC2(CC1)OC[C@H](O2)CO
Synonyms:
  • 1,4-Dioxaspiro[4.5]decane-2-methanol, (2R)-
Found 0 products.