
CAS 1138-48-3
:rel-1,1′-(1R,2S)-1,2-Cyclopropanediylbis[benzene]
Description:
Rel-1,1′-(1R,2S)-1,2-Cyclopropanediylbis[benzene], with the CAS number 1138-48-3, is an organic compound characterized by its unique structure, which features a cyclopropane moiety connected to two benzene rings. This compound exhibits chirality due to the presence of stereogenic centers in the cyclopropane unit, leading to specific optical isomers. The presence of the benzene rings contributes to its aromatic properties, which can influence its reactivity and stability. Typically, compounds of this nature may exhibit interesting electronic properties due to the conjugation between the aromatic systems and the cyclopropane bridge. Additionally, the rigidity of the cyclopropane structure can affect the compound's overall conformation and steric interactions. Such characteristics make it of interest in various fields, including materials science and organic synthesis, where it may serve as a building block or a ligand in coordination chemistry. Its physical properties, such as solubility and melting point, would depend on the specific interactions between the aromatic rings and the surrounding environment.
Formula:C15H14
InChI:InChI=1/C15H14/c1-3-7-12(8-4-1)14-11-15(14)13-9-5-2-6-10-13/h1-10,14-15H,11H2/t14-,15+
InChI key:InChIKey=ZSIYTDQNAOYUNE-GASCZTMLNA-N
SMILES:[C@@H]1([C@H](C1)C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- cis-1,2-Diphenylcyclopropane
- Benzene, 1,1′-(1,2-cyclopropanediyl)bis-, cis-
- rel-1,1′-(1R,2S)-1,2-Cyclopropanediylbis[benzene]
- Benzene, 1,1′-(1R,2S)-1,2-cyclopropanediylbis-, rel-
- Cyclopropane, 1,2-diphenyl-, cis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
