CAS 1138-52-9
:3,5-Di-tert-butylphenol
Description:
3,5-Di-tert-butylphenol is an organic compound characterized by its phenolic structure, featuring two tert-butyl groups attached to the 3 and 5 positions of the benzene ring. This compound is known for its antioxidant properties, making it useful in various industrial applications, particularly in the stabilization of polymers and plastics against oxidative degradation. It appears as a white to light yellow crystalline solid and is relatively insoluble in water but soluble in organic solvents. The presence of the bulky tert-butyl groups enhances its steric hindrance, contributing to its stability and effectiveness as an antioxidant. Additionally, 3,5-Di-tert-butylphenol exhibits low toxicity, although it should still be handled with care due to potential irritant effects. Its chemical formula is C14H22O, and it has a melting point that typically falls within a specific range, indicating its solid state at room temperature. Overall, this compound plays a significant role in various chemical processes and formulations, particularly in the field of materials science.
Formula:C14H22O
InChI:InChI=1/C14H22O/c1-13(2,3)10-7-11(14(4,5)6)9-12(15)8-10/h7-9,15H,1-6H3
InChI key:InChIKey=ZDWSNKPLZUXBPE-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=CC(C(C)(C)C)=CC(O)=C1
Synonyms:- 3,5-Bis(1,1-dimethylethyl)phenol
- 3,5-Bis(tert-butyl)phenol
- 3,5-Di-t-butylphenol
- 3,5-Ditert-butylphenol
- Nsc 68209
- Phenol, 3,5-bis(1,1-dimethylethyl)-
- Phenol, 3,5-di-tert-butyl-
- 3,5-Di-tert-butylphenol
- 3,5-bis(1,1-dimethylethyl)-pheno
- Phenol, 3,5-bis(t-butyl)
- LABOTEST-BB LT00053483
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
3,5-Di-tert-butylphenol
CAS:Monophenols, nesoiFormula:C14H22OColor and Shape:White SolidMolecular weight:206.16707Phenol, 3,5-bis(1,1-dimethylethyl)-
CAS:Formula:C14H22OPurity:95%Color and Shape:SolidMolecular weight:206.3239Ref: IN-DA0009PL
5kgTo inquire1g20.00€5g28.00€10g46.00€25g66.00€50g104.00€100g140.00€250g157.00€500g238.00€1kg281.00€3,5-Di-tert-butylphenol
CAS:3,5-Di-tert-butylphenol induces accumulation of reactive oxygen species. 3,5-Di-tert-butylphenol exhibits anti-biofilm and antifungal activities.Formula:C14H22OPurity:99.905% - 99.93%Color and Shape:Off-White Crystals Or PowderMolecular weight:206.323,5-Di-Tert-Butylphenol, 10mM (in DMSO)
CAS:3,5-Di-Tert-Butylphenol, 10mM (in DMSO)Purity:≥98%Molecular weight:206.32g/mol3,5-Di-tert-butylphenol
CAS:Controlled ProductFormula:C14H22OColor and Shape:NeatMolecular weight:206.323,5-Di-tert-butylphenol
CAS:Controlled ProductApplications 3,5-DI-TERT-BUTYLPHENOL (cas# 1138-52-9) is a useful research chemical.
Formula:C14H22OColor and Shape:Light BrownMolecular weight:206.323,5-Di-tert-butylphenol
CAS:3,5-Di-tert-butylphenol is a reactive compound that has been used as an analytical control agent. It has been shown to have an absorption maximum at 230 nm and a strong absorption band in the ultraviolet region of the spectrum. 3,5-Di-tert-butylphenol is also known to have a high uptake capacity for citric acid and sodium carbonate in uptake assays. The hydrogen bond between 3,5-Di-tert-butylphenol and p-hydroxybenzoic acid is intramolecular and can be broken by heating with acetate extract. This compound has been shown to be toxic in Sprague Dawley rats. 3,5-Di-tert-butylphenol undergoes activation energies of 2.6 kcal/mol (1) and 10 kcal/mol (2).
Formula:C14H22OPurity:Min. 95%Molecular weight:206.33 g/mol










