CAS 1138-52-9: 3,5-Di-tert-butylphenol
Description:3,5-Di-tert-butylphenol is an organic compound characterized by its phenolic structure, featuring two tert-butyl groups attached to the 3 and 5 positions of the benzene ring. This compound is known for its antioxidant properties, making it useful in various industrial applications, particularly in the stabilization of polymers and plastics against oxidative degradation. It appears as a white to light yellow crystalline solid and is relatively insoluble in water but soluble in organic solvents. The presence of the bulky tert-butyl groups enhances its steric hindrance, contributing to its stability and effectiveness as an antioxidant. Additionally, 3,5-Di-tert-butylphenol exhibits low toxicity, although it should still be handled with care due to potential irritant effects. Its chemical formula is C14H22O, and it has a melting point that typically falls within a specific range, indicating its solid state at room temperature. Overall, this compound plays a significant role in various chemical processes and formulations, particularly in the field of materials science.
Formula:C14H22O
InChI:InChI=1S/C14H22O/c1-13(2,3)10-7-11(14(4,5)6)9-12(15)8-10/h7-9,15H,1-6H3
InChI key:InChIKey=ZDWSNKPLZUXBPE-UHFFFAOYSA-N
SMILES:OC=1C=C(C=C(C1)C(C)(C)C)C(C)(C)C
- Synonyms:
- 3,5-Bis(1,1-dimethylethyl)phenol
- 3,5-Bis(tert-butyl)phenol
- 3,5-Di-t-butylphenol
- 3,5-Ditert-butylphenol
- Nsc 68209
- Phenol, 3,5-bis(1,1-dimethylethyl)-
- Phenol, 3,5-di-tert-butyl-
- 3,5-Di-tert-butylphenol