
CAS 1138-55-2
:4-(2-Methylpropoxy)benzenesulfonamide
Description:
4-(2-Methylpropoxy)benzenesulfonamide, with the CAS number 1138-55-2, is an organic compound characterized by its sulfonamide functional group attached to a benzene ring. This compound features a propoxy group, specifically a 2-methylpropoxy substituent, which contributes to its hydrophobic properties. The presence of the sulfonamide group imparts potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the sulfonamide moiety. Its molecular structure suggests potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the benzene ring. Overall, 4-(2-Methylpropoxy)benzenesulfonamide is a compound of interest in both synthetic organic chemistry and pharmacology, warranting further investigation into its properties and potential uses.
Formula:C10H15NO3S
InChI:InChI=1S/C10H15NO3S/c1-8(2)7-14-9-3-5-10(6-4-9)15(11,12)13/h3-6,8H,7H2,1-2H3,(H2,11,12,13)
InChI key:InChIKey=IWCHIVARCLCQFS-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=CC=C(OCC(C)C)C=C1
Synonyms:- 4-(2-Methylpropoxy)benzenesulfonamide
- Benzenesulfonamide, p-isobutoxy-
- Benzenesulfonamide, 4-(2-methylpropoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.