CAS 1138-99-4
:Trifluorodiphenylphosphorane
Description:
Trifluorodiphenylphosphorane, with the CAS number 1138-99-4, is a chemical compound characterized by its unique structure, which includes a phosphorus atom bonded to two phenyl groups and three fluorine atoms. This compound is known for its high reactivity, particularly as a strong nucleophile due to the presence of the phosphorus atom, which can participate in various chemical reactions, including nucleophilic substitutions. The trifluoromethyl groups enhance its electrophilic character, making it useful in organic synthesis, particularly in the formation of phosphonium salts and in the preparation of other organophosphorus compounds. Trifluorodiphenylphosphorane is typically a solid at room temperature and is sensitive to moisture and air, requiring careful handling and storage conditions. Its applications extend to the fields of medicinal chemistry and materials science, where it can serve as a reagent in the synthesis of complex organic molecules. Overall, its distinctive properties make it a valuable compound in various chemical research and industrial applications.
Formula:C12H10F3P
InChI:InChI=1S/C12H10F3P/c13-16(14,15,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H
InChI key:InChIKey=CVYZCIFAHYJSCQ-UHFFFAOYSA-N
SMILES:P(F)(F)(F)(C1=CC=CC=C1)C2=CC=CC=C2
Synonyms:- Diphenylphosphine trifluoride~Diphenyltrifluorophosphorane
- Diphenyltrifluorophosphorane
- Phosphorane, trifluorodiphenyl-
- Trifluoro(Diphenyl)-Lambda~5~-Phosphane
- Trifluorodiphenylphosphorane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
