CAS 1138011-18-3

Benzeneacetaldehyde, 3,4-dimethoxy-α-oxo-, hydrate (1:1)

Description:

Benzeneacetaldehyde, 3,4-dimethoxy-α-oxo-, hydrate (1:1) is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with an acetaldehyde group and two methoxy groups at the 3 and 4 positions. The presence of the α-oxo functional group indicates that it possesses a carbonyl functionality, contributing to its reactivity and potential applications in organic synthesis. As a hydrate, it exists in a form that includes water molecules, which can influence its solubility and stability. This compound may exhibit various physical properties such as a specific melting point, boiling point, and solubility in organic solvents, which are typical for aromatic aldehydes and their derivatives. Its unique structure suggests potential uses in the fragrance industry, as well as in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₁₀H₁₀O₄·H₂O

InChI: InChI=1S/C10H10O4.H2O/c1-13-9-4-3-7(8(12)6-11)5-10(9)14-2;/h3-6H,1-2H3;1H2

InChI key: InChIKey=HVXVAKHTLMPFDQ-UHFFFAOYSA-N

SMILES: O(C)C1=C(OC)C=CC(C(C=O)=O)=C1.O

Synonyms:

• (3,4-Dimethoxyphenyl)(oxo)acetaldehyde hydrate (1:1)
• Benzeneacetaldehyde, 3,4-dimethoxy-α-oxo-, hydrate (1:1)