CymitQuimica logo

CAS 1138011-20-7

:

3-Fluoro-2-methoxy-5-(trifluoromethyl)pyridine

Description:
3-Fluoro-2-methoxy-5-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a fluorine atom at the 3-position and a methoxy group at the 2-position contributes to its unique chemical properties. Additionally, the trifluoromethyl group at the 5-position significantly enhances its lipophilicity and can influence its reactivity and biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is soluble in organic solvents, reflecting its non-polar characteristics due to the trifluoromethyl group. The compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and agrochemical applications. Its synthesis often involves fluorination and methoxylation reactions, and it can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure and purity. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C7H5F4NO
InChI:InChI=1S/C7H5F4NO/c1-13-6-5(8)2-4(3-12-6)7(9,10)11/h2-3H,1H3
InChI key:InChIKey=IHOIUDOVZDEYLS-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(F)C(OC)=NC1
Synonyms:
  • Pyridine, 3-fluoro-2-methoxy-5-(trifluoromethyl)-
  • 3-Fluoro-2-methoxy-5-(trifluoromethyl)pyridine
Found 3 products.