CAS 1138036-54-0: 2-Chloro-3-fluoro hydrazine hydrochloride
Description:2-Chloro-3-fluoro hydrazine hydrochloride is an organic compound characterized by the presence of both chlorine and fluorine substituents on a hydrazine backbone. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its stability and solubility in polar solvents, particularly water. This compound is notable for its potential applications in pharmaceuticals and agrochemicals, where its reactivity can be harnessed in various synthetic pathways. The presence of halogens (chlorine and fluorine) often imparts unique electronic properties, influencing the compound's reactivity and interaction with biological systems. Additionally, like many hydrazine derivatives, it may exhibit properties such as being a reducing agent or participating in nucleophilic substitution reactions. Safety considerations are paramount when handling this substance, as hydrazines can be toxic and potentially hazardous. Proper storage and handling protocols should be observed to mitigate risks associated with exposure. Overall, 2-Chloro-3-fluoro hydrazine hydrochloride is a compound of interest in chemical research and development due to its distinctive structural features and reactivity.
Formula:C6H6ClFN2.ClH
InChI:InChI=1S/C6H6ClFN2.ClH/c7-6-4(8)2-1-3-5(6)10-9;/h1-3,10H,9H2;1H
InChI key:InChIKey=YYQJPDKDXVQERR-UHFFFAOYSA-N
SMILES:Cl.FC1=CC=CC(NN)=C1Cl
Hydrazine, (2-chloro-3-fluorophenyl)-, hydrochloride (1:1)
Ref: IN-DA0009QH
| 1g | 25.00 € | ||
| 5g | 56.00 € | ||
| 10g | 86.00 € | ||
| 25g | 162.00 € | ||
| 100g | 532.00 € |
(2-Chloro-3-fluorophenyl)hydrazine Hydrochloride
Ref: 3B-C3677
| 1g | 147.00 € |
2-Chloro-3-fluoro-hydrazine hydrochloride
Ref: 54-PC50314
| 25g | 216.00 € | ||
| 100g | 524.00 € |
(2-Chloro-3-fluorophenyl)hydrazine hydrochloride
Ref: 10-F095017
| 5g | 61.00 € | ||
| 10g | 75.00 € | ||
| 25g | 170.00 € |
2-Chloro-3-fluoro-hydrazine hydrochloride
Ref: 3D-NVB03654
| 250mg | 348.00 € | ||
| 2500mg | 965.00 € |
