CAS 1138217-86-3
:5-Fluoro-2-(4-piperidinyl)pyridine
Description:
5-Fluoro-2-(4-piperidinyl)pyridine is a chemical compound characterized by its pyridine ring, which is substituted at the 2-position with a piperidine group and at the 5-position with a fluorine atom. This structure contributes to its potential biological activity, particularly in medicinal chemistry, where such compounds may exhibit properties relevant to pharmacology. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, while the piperidine moiety may influence receptor binding and activity. The compound is typically a solid at room temperature and may be soluble in organic solvents. Its molecular formula and specific physical properties, such as melting point and boiling point, would depend on the purity and specific conditions of the sample. As with many fluorinated compounds, it may also exhibit unique reactivity patterns and interactions with biological systems, making it of interest in drug discovery and development. Safety data should be consulted for handling and potential hazards associated with this substance.
Formula:C10H13FN2
InChI:InChI=1S/C10H13FN2/c11-9-1-2-10(13-7-9)8-3-5-12-6-4-8/h1-2,7-8,12H,3-6H2
InChI key:InChIKey=MCSRVNMGHZPKBW-UHFFFAOYSA-N
SMILES:FC1=CC=C(N=C1)C2CCNCC2
Synonyms:- 5-Fluoro-2-(4-piperidinyl)pyridine
- 4-(5-Fluoro-2-pyridyl)piperidine
- Pyridine, 5-fluoro-2-(4-piperidinyl)-
- 5-fluoro-2-(piperidin-4-yl)pyridine
- 5-Fluoro-1',2',3',4',5',6'-hexahydro-[2,4']bipyridinyl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.