CAS 113823-56-6

1H,1H,2H,2H-PERFLUORODECYL P-TOLUENESULFONATE

Description:

1H,1H,2H,2H-Perfluorodecyl p-toluenesulfonate is a fluorinated organic compound characterized by its perfluorinated alkyl chain and sulfonate functional group. The presence of a perfluorinated decyl group imparts unique properties, such as low surface energy, high chemical stability, and resistance to thermal degradation, making it useful in various applications, including surfactants and coatings. The p-toluenesulfonate moiety enhances its solubility in organic solvents while maintaining its surfactant properties. This compound is typically used in specialized formulations, including those in the fields of materials science and nanotechnology. Its fluorinated structure contributes to its hydrophobic characteristics, which can be advantageous in applications requiring water repellency. However, due to the environmental persistence of perfluorinated compounds, there are ongoing discussions regarding their ecological impact and regulatory considerations. Overall, 1H,1H,2H,2H-Perfluorodecyl p-toluenesulfonate exemplifies the intersection of functional chemistry and environmental awareness in modern applications.

Formula: C₁₇H₁₁F₁₇O₃S

InChI: InChI=1/C17H11F17O3S/c1-8-2-4-9(5-3-8)38(35,36)37-7-6-10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)34/h2-5H,6-7H2,1H3

SMILES: Cc1ccc(cc1)S(=O)(=O)OCCC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F

Synonyms:

• 1H,1H,2H,2H-Perfluorodecyl P-Toluenesulfonate, 97% Min.