
CAS 113826-07-6
:3-[[1-(2,4-Dichlorophenyl)butyl]sulfonyl]pyridine
Description:
3-[[1-(2,4-Dichlorophenyl)butyl]sulfonyl]pyridine, with the CAS number 113826-07-6, is a chemical compound characterized by its sulfonyl group attached to a pyridine ring, along with a butyl chain that is substituted with a dichlorophenyl moiety. This structure suggests that it may exhibit properties typical of sulfonamides, including potential biological activity. The presence of the dichlorophenyl group indicates that the compound may have significant lipophilicity, which can influence its solubility and permeability in biological systems. Additionally, the pyridine ring can participate in various chemical interactions, such as hydrogen bonding and coordination with metal ions. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential activity against specific biological targets. However, detailed studies would be necessary to fully elucidate its properties, including its reactivity, stability, and biological effects. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated groups.
Formula:C15H15Cl2NO2S
InChI:InChI=1S/C15H15Cl2NO2S/c1-2-4-15(13-7-6-11(16)9-14(13)17)21(19,20)12-5-3-8-18-10-12/h3,5-10,15H,2,4H2,1H3
InChI key:InChIKey=NQQFOBSOHQMGME-UHFFFAOYSA-N
SMILES:C(S(=O)(=O)C=1C=CC=NC1)(CCC)C2=C(Cl)C=C(Cl)C=C2
Synonyms:- Pyridine, 3-[[1-(2,4-dichlorophenyl)butyl]sulfonyl]-
- 3-[[1-(2,4-Dichlorophenyl)butyl]sulfonyl]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pyridine, 3-[[1-(2,4-dichlorophenyl)butyl]sulfonyl]-
CAS:Formula:C15H15Cl2NO2SMolecular weight:344.2561
