CymitQuimica logo

CAS 1138442-38-2

:

2-Bromo-N-[3-[(2-methyl-2-propen-1-yl)oxy]phenyl]acetamide

Description:
2-Bromo-N-[3-[(2-methyl-2-propen-1-yl)oxy]phenyl]acetamide is a chemical compound characterized by its unique structure, which includes a bromine atom, an acetamide functional group, and a phenyl ring substituted with an allyl ether. This compound is likely to exhibit properties typical of amides, such as moderate polarity and potential hydrogen bonding capabilities, which can influence its solubility in various solvents. The presence of the bromine atom may impart specific reactivity, making it a candidate for nucleophilic substitution reactions. Additionally, the allyl ether group can provide sites for further chemical modifications, enhancing its utility in synthetic organic chemistry. The compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such functional groups are often integral to biological activity. Overall, the characteristics of this compound, including its reactivity and functional groups, make it a subject of interest for further research and application in various chemical fields.
Formula:C12H14BrNO2
InChI:InChI=1S/C12H14BrNO2/c1-9(2)8-16-11-5-3-4-10(6-11)14-12(15)7-13/h3-6H,1,7-8H2,2H3,(H,14,15)
InChI key:InChIKey=CKRLSWZRFQECQP-UHFFFAOYSA-N
SMILES:N(C(CBr)=O)C1=CC(OCC(C)=C)=CC=C1
Synonyms:
  • Acetamide, 2-bromo-N-[3-[(2-methyl-2-propen-1-yl)oxy]phenyl]-
  • 2-Bromo-N-[3-[(2-methyl-2-propen-1-yl)oxy]phenyl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.