CAS 1138443-69-2

3-[(2-Bromoacetyl)amino]-N,N-dimethylbenzenepropanamide

Description:

3-[(2-Bromoacetyl)amino]-N,N-dimethylbenzenepropanamide is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with a dimethylamino group and a propanamide moiety. The presence of a bromoacetyl group introduces notable reactivity, particularly in nucleophilic substitution reactions. This compound is likely to exhibit polar characteristics due to the amide functional group, which can engage in hydrogen bonding, influencing its solubility in various solvents. The bromine atom contributes to the compound's potential for electrophilic reactions, making it a candidate for further chemical transformations. Additionally, the dimethylamino group may impart basic properties, affecting its interaction with acids and bases. Overall, this compound's unique functional groups suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, where modifications to the benzene ring can lead to diverse biological activities. However, specific safety and handling guidelines should be followed due to the presence of bromine and the potential for toxicity associated with certain amides.

Formula: C₁₃H₁₇BrN₂O₂

InChI: InChI=1S/C13H17BrN2O2/c1-16(2)13(18)7-6-10-4-3-5-11(8-10)15-12(17)9-14/h3-5,8H,6-7,9H2,1-2H3,(H,15,17)

InChI key: InChIKey=XRHKPSFNDHEYGG-UHFFFAOYSA-N

SMILES: C(CC(N(C)C)=O)C1=CC(NC(CBr)=O)=CC=C1

Synonyms:

• Benzenepropanamide, 3-[(2-bromoacetyl)amino]-N,N-dimethyl-
• 3-[(2-Bromoacetyl)amino]-N,N-dimethylbenzenepropanamide